About 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine
2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine (PubChem CID 89060361) has the molecular formula C12H15ClF4N2O
and a molecular weight of 314.71 g/mol. Its IUPAC name is 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine |
| PubChem CID | 89060361 |
| Molecular Formula | C12H15ClF4N2O |
| Molecular Weight | 314.71 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine |
| SMILES | CCCCC(C)C(Oc1nc(Cl)ncc1F)C(F)(F)F |
| InChI | InChI=1S/C12H15ClF4N2O/c1-3-4-5-7(2)9(12(15,16)17)20-10-8(14)6-18-11(13)19-10/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | IATCCTDLDWXOKN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine?
The IUPAC name of 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine (CID 89060361) is 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine.
What is the SMILES notation for 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine?
The canonical SMILES for 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine is CCCCC(C)C(Oc1nc(Cl)ncc1F)C(F)(F)F.
What is the InChIKey of 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine?
The InChIKey is IATCCTDLDWXOKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF4N2O/c1-3-4-5-7(2)9(12(15,16)17)20-10-8(14)6-18-11(13)19-10/h6-7,9H,3-5H2,1-2H3.
What are the key properties of 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine?
2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine has a molecular weight of 314.71 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-fluoro-4-(1,1,1-trifluoro-3-methylheptan-2-yl)oxypyrimidine is sourced from PubChem (CID 89060361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).