C12H18N2O4S3 — CID 89060388
(2S,4S)-4-(ethylamino)-N,2-dimethyl-1,1-dioxo-7-sulfanylidene-3,4-dihydro-2H-cyclopenta[b]thiopyran-6-sulfonamide (PubChem CID 89060388) has the molecular formula C12H18N2O4S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is (2S,4S)-4-(ethylamino)-N,2-dimethyl-1,1-dioxo-7-sulfanylidene-3,4-dihydro-2H-cyclopenta[b]thiopyran-6-sulfonamide.
| Compound Name | (2S,4S)-4-(ethylamino)-N,2-dimethyl-1,1-dioxo-7-sulfanylidene-3,4-dihydro-2H-cyclopenta[b]thiopyran-6-sulfonamide |
|---|---|
| PubChem CID | 89060388 |
| Molecular Formula | C12H18N2O4S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | (2S,4S)-4-(ethylamino)-N,2-dimethyl-1,1-dioxo-7-sulfanylidene-3,4-dihydro-2H-cyclopenta[b]thiopyran-6-sulfonamide |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)C2=C1C=C(S(=O)(=O)NC)C2=S |
| InChI | InChI=1S/C12H18N2O4S3/c1-4-14-9-5-7(2)20(15,16)12-8(9)6-10(11(12)19)21(17,18)13-3/h6-7,9,13-14H,4-5H2,1-3H3/t7-,9-/m0/s1 |
| InChIKey | MEMQTGKQQAQRKP-CBAPKCEASA-N |
| XLogP | 0.24 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|