C7H10ClNO — CID 89060582
(2E,4E,6E)-7-amino-5-chlorohepta-2,4,6-trien-2-ol (PubChem CID 89060582) has the molecular formula C7H10ClNO and a molecular weight of 159.62 g/mol. Its IUPAC name is (2E,4E,6E)-7-amino-5-chlorohepta-2,4,6-trien-2-ol.
| Compound Name | (2E,4E,6E)-7-amino-5-chlorohepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 89060582 |
| Molecular Formula | C7H10ClNO |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2E,4E,6E)-7-amino-5-chlorohepta-2,4,6-trien-2-ol |
| SMILES | C/C(O)=C\C=C(Cl)/C=C/N |
| InChI | InChI=1S/C7H10ClNO/c1-6(10)2-3-7(8)4-5-9/h2-5,10H,9H2,1H3/b5-4+,6-2+,7-3+ |
| InChIKey | PEQOGPAZMMZFDO-WMBARIMRSA-N |
| XLogP | 2.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|