C31H64N4O2 — CID 89061392
3-[2-[[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]-propan-2-ylamino]ethyl-propan-2-ylamino]-N-(2,2,4-trimethylpentyl)propanamide (PubChem CID 89061392) has the molecular formula C31H64N4O2 and a molecular weight of 524.88 g/mol. Its IUPAC name is 3-[2-[[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]-propan-2-ylamino]ethyl-propan-2-ylamino]-N-(2,2,4-trimethylpentyl)propanamide.
| Compound Name | 3-[2-[[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]-propan-2-ylamino]ethyl-propan-2-ylamino]-N-(2,2,4-trimethylpentyl)propanamide |
|---|---|
| PubChem CID | 89061392 |
| Molecular Formula | C31H64N4O2 |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 524.50 |
| IUPAC Name | 3-[2-[[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]-propan-2-ylamino]ethyl-propan-2-ylamino]-N-(2,2,4-trimethylpentyl)propanamide |
| SMILES | CC(C)CC(C)(C)CNC(=O)CCN(CCN(CCC(=O)NCC(C)(C)CC(C)(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C31H64N4O2/c1-24(2)20-30(10,11)22-32-27(36)14-16-34(25(3)4)18-19-35(26(5)6)17-15-28(37)33-23-31(12,13)21-29(7,8)9/h24-26H,14-23H2,1-13H3,(H,32,36)(H,33,37) |
| InChIKey | RVZVRQFOUCPXMU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |