C15H31N3O2 — CID 89061424
3-[2-(2-hydroxyethylamino)ethylamino]-N-(2,2,4-trimethylpent-3-enyl)propanamide (PubChem CID 89061424) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethylamino)ethylamino]-N-(2,2,4-trimethylpent-3-enyl)propanamide.
| Compound Name | 3-[2-(2-hydroxyethylamino)ethylamino]-N-(2,2,4-trimethylpent-3-enyl)propanamide |
|---|---|
| PubChem CID | 89061424 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 3-[2-(2-hydroxyethylamino)ethylamino]-N-(2,2,4-trimethylpent-3-enyl)propanamide |
| SMILES | CC(C)=CC(C)(C)CNC(=O)CCNCCNCCO |
| InChI | InChI=1S/C15H31N3O2/c1-13(2)11-15(3,4)12-18-14(20)5-6-16-7-8-17-9-10-19/h11,16-17,19H,5-10,12H2,1-4H3,(H,18,20) |
| InChIKey | ONRGFKJTSYMQMM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|