About N,N',2-trimethylpropane-1,3-diimine
N,N',2-trimethylpropane-1,3-diimine (PubChem CID 89061546) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is N,N',2-trimethylpropane-1,3-diimine.
Molecular Properties
| Compound Name | N,N',2-trimethylpropane-1,3-diimine |
| PubChem CID | 89061546 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | N,N',2-trimethylpropane-1,3-diimine |
| SMILES | C/N=C/C(C)/C=N/C |
| InChI | InChI=1S/C6H12N2/c1-6(4-7-2)5-8-3/h4-6H,1-3H3/b7-4+,8-5+ |
| InChIKey | CPFNEEAKJOIBCK-NSLJXJERSA-N |
| XLogP | 1.02 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N',2-trimethylpropane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N',2-trimethylpropane-1,3-diimine?
The IUPAC name of N,N',2-trimethylpropane-1,3-diimine (CID 89061546) is N,N',2-trimethylpropane-1,3-diimine.
What is the SMILES notation for N,N',2-trimethylpropane-1,3-diimine?
The canonical SMILES for N,N',2-trimethylpropane-1,3-diimine is C/N=C/C(C)/C=N/C.
What is the InChIKey of N,N',2-trimethylpropane-1,3-diimine?
The InChIKey is CPFNEEAKJOIBCK-NSLJXJERSA-N. The full InChI is InChI=1S/C6H12N2/c1-6(4-7-2)5-8-3/h4-6H,1-3H3/b7-4+,8-5+.
What are the key properties of N,N',2-trimethylpropane-1,3-diimine?
N,N',2-trimethylpropane-1,3-diimine has a molecular weight of 112.18 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N',2-trimethylpropane-1,3-diimine is sourced from PubChem (CID 89061546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).