About spiro[5.5]undeca-1,4-dien-9-one
spiro[5.5]undeca-1,4-dien-9-one (PubChem CID 89061769) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is spiro[5.5]undeca-1,4-dien-9-one.
Molecular Properties
| Compound Name | spiro[5.5]undeca-1,4-dien-9-one |
| PubChem CID | 89061769 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | spiro[5.5]undeca-1,4-dien-9-one |
| SMILES | O=C1CCC2(C=CCC=C2)CC1 |
| InChI | InChI=1S/C11H14O/c12-10-4-8-11(9-5-10)6-2-1-3-7-11/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | QJNUFQSBKIFLHR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[5.5]undeca-1,4-dien-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5.5]undeca-1,4-dien-9-one?
The IUPAC name of spiro[5.5]undeca-1,4-dien-9-one (CID 89061769) is spiro[5.5]undeca-1,4-dien-9-one.
What is the SMILES notation for spiro[5.5]undeca-1,4-dien-9-one?
The canonical SMILES for spiro[5.5]undeca-1,4-dien-9-one is O=C1CCC2(C=CCC=C2)CC1.
What is the InChIKey of spiro[5.5]undeca-1,4-dien-9-one?
The InChIKey is QJNUFQSBKIFLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c12-10-4-8-11(9-5-10)6-2-1-3-7-11/h2-3,6-7H,1,4-5,8-9H2.
What are the key properties of spiro[5.5]undeca-1,4-dien-9-one?
spiro[5.5]undeca-1,4-dien-9-one has a molecular weight of 162.23 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5.5]undeca-1,4-dien-9-one is sourced from PubChem (CID 89061769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).