C33H21IN2O6 — CID 89062106
N-[4-[4-[(2-iodoacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]propanamide (PubChem CID 89062106) has the molecular formula C33H21IN2O6 and a molecular weight of 668.44 g/mol. Its IUPAC name is N-[4-[4-[(2-iodoacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]propanamide.
| Compound Name | N-[4-[4-[(2-iodoacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]propanamide |
|---|---|
| PubChem CID | 89062106 |
| Molecular Formula | C33H21IN2O6 |
| Molecular Weight | 668.44 g/mol |
| Exact Mass | 668.04 |
| IUPAC Name | N-[4-[4-[(2-iodoacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc(-c2ccc(NC(=O)CI)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C33H21IN2O6/c1-2-24(37)35-22-13-11-16(26-28(22)32(41)20-9-5-3-7-18(20)30(26)39)17-12-14-23(36-25(38)15-34)29-27(17)31(40)19-8-4-6-10-21(19)33(29)42/h3-14H,2,15H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | DHQATIQMBDPRSK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|