C23H36N6O2 — CID 89062128
amino 1-(2-aminoethyl)-N-[(3E,4Z)-3-(1-aminoethylidene)-5-ethyl-6-hydroxyhepta-1,4,6-trien-2-yl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate (PubChem CID 89062128) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is amino 1-(2-aminoethyl)-N-[(3E,4Z)-3-(1-aminoethylidene)-5-ethyl-6-hydroxyhepta-1,4,6-trien-2-yl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate.
| Compound Name | amino 1-(2-aminoethyl)-N-[(3E,4Z)-3-(1-aminoethylidene)-5-ethyl-6-hydroxyhepta-1,4,6-trien-2-yl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate |
|---|---|
| PubChem CID | 89062128 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | amino 1-(2-aminoethyl)-N-[(3E,4Z)-3-(1-aminoethylidene)-5-ethyl-6-hydroxyhepta-1,4,6-trien-2-yl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate |
| SMILES | C=C(O)/C(=C\C(C(=C)/N=C(/ON)c1nn(CCN)c2c1CCC(C)(C)C2)=C(\C)N)CC |
| InChI | InChI=1S/C23H36N6O2/c1-7-17(16(4)30)12-19(14(2)25)15(3)27-22(31-26)21-18-8-9-23(5,6)13-20(18)29(28-21)11-10-24/h12,30H,3-4,7-11,13,24-26H2,1-2,5-6H3/b17-12-,19-14+,27-22+ |
| InChIKey | XWCFAFLYGJZDPA-BNQRVHSMSA-N |
| XLogP | 3.15 |
| TPSA | 137.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|