C21H29N5O2 — CID 89062156
amino N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-1,6,6-trimethyl-5,7-dihydro-4H-indazole-3-carboximidate (PubChem CID 89062156) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is amino N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-1,6,6-trimethyl-5,7-dihydro-4H-indazole-3-carboximidate.
| Compound Name | amino N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-1,6,6-trimethyl-5,7-dihydro-4H-indazole-3-carboximidate |
|---|---|
| PubChem CID | 89062156 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | amino N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-1,6,6-trimethyl-5,7-dihydro-4H-indazole-3-carboximidate |
| SMILES | C=C(/N=C(/ON)c1nn(C)c2c1CCC(C)(C)C2)c1cc(CC)c(=O)[nH]c1C |
| InChI | InChI=1S/C21H29N5O2/c1-7-14-10-16(12(2)23-19(14)27)13(3)24-20(28-22)18-15-8-9-21(4,5)11-17(15)26(6)25-18/h10H,3,7-9,11,22H2,1-2,4-6H3,(H,23,27)/b24-20+ |
| InChIKey | KMNBKURUPIMFLE-HIXSDJFHSA-N |
| XLogP | 2.80 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|