C11H19N3 — CID 89062309
(3E,5E)-6-(4-methylpiperazin-1-yl)hexa-1,3,5-trien-3-amine (PubChem CID 89062309) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (3E,5E)-6-(4-methylpiperazin-1-yl)hexa-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-6-(4-methylpiperazin-1-yl)hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89062309 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (3E,5E)-6-(4-methylpiperazin-1-yl)hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C\N1CCN(C)CC1 |
| InChI | InChI=1S/C11H19N3/c1-3-11(12)5-4-6-14-9-7-13(2)8-10-14/h3-6H,1,7-10,12H2,2H3/b6-4+,11-5+ |
| InChIKey | KCTAGVXUXAPVJU-KGUOMNFLSA-N |
| XLogP | 0.78 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|