C13H24ClNO7 — CID 89062572
ethyl (2R)-2-[chloro-[1-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-yl]amino]-3-hydroxypropanoate (PubChem CID 89062572) has the molecular formula C13H24ClNO7 and a molecular weight of 341.79 g/mol. Its IUPAC name is ethyl (2R)-2-[chloro-[1-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-yl]amino]-3-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-[chloro-[1-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-yl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 89062572 |
| Molecular Formula | C13H24ClNO7 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | ethyl (2R)-2-[chloro-[1-[(2S,3R,5R)-3,4,5-trihydroxyoxan-2-yl]propan-2-yl]amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@@H](CO)N(Cl)C(C)C[C@@H]1OC[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C13H24ClNO7/c1-3-21-13(20)8(5-16)15(14)7(2)4-10-12(19)11(18)9(17)6-22-10/h7-12,16-19H,3-6H2,1-2H3/t7?,8-,9-,10+,11?,12+/m1/s1 |
| InChIKey | NMCTXDHAYUYAKV-ZFMRPWARSA-N |
| XLogP | -1.37 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|