C33H45N11O4S — CID 89062728
3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-ethyl-2-methylbutanoate (PubChem CID 89062728) has the molecular formula C33H45N11O4S and a molecular weight of 691.86 g/mol. Its IUPAC name is 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-ethyl-2-methylbutanoate.
| Compound Name | 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-ethyl-2-methylbutanoate |
|---|---|
| PubChem CID | 89062728 |
| Molecular Formula | C33H45N11O4S |
| Molecular Weight | 691.86 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-ethyl-2-methylbutanoate |
| SMILES | CCC(C)(CC)C(=O)OCCCNc1nc(NC(C)COC)nc(NC(C)COC)c1/N=N/c1nn(-c2nc3ccccc3s2)cc1C#N |
| InChI | InChI=1S/C33H45N11O4S/c1-8-33(5,9-2)30(45)48-16-12-15-35-28-26(29(36-21(3)19-46-6)40-31(39-28)37-22(4)20-47-7)41-42-27-23(17-34)18-44(43-27)32-38-24-13-10-11-14-25(24)49-32/h10-11,13-14,18,21-22H,8-9,12,15-16,19-20H2,1-7H3,(H3,35,36,37,39,40)/b42-41+ |
| InChIKey | HVTUKIYURZMCAD-WQVHNPAPSA-N |
| XLogP | 6.62 |
| TPSA | 185.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.86 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|