About (1Z)-cyclodecene-1,2-diamine
(1Z)-cyclodecene-1,2-diamine (PubChem CID 89062858) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is (1Z)-cyclodecene-1,2-diamine.
Molecular Properties
| Compound Name | (1Z)-cyclodecene-1,2-diamine |
| PubChem CID | 89062858 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (1Z)-cyclodecene-1,2-diamine |
| SMILES | N/C1=C(\N)CCCCCCCC1 |
| InChI | InChI=1S/C10H20N2/c11-9-7-5-3-1-2-4-6-8-10(9)12/h1-8,11-12H2/b10-9- |
| InChIKey | XNHCIMAISSXTLS-KTKRTIGZSA-N |
| XLogP | 2.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1Z)-cyclodecene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-cyclodecene-1,2-diamine?
The IUPAC name of (1Z)-cyclodecene-1,2-diamine (CID 89062858) is (1Z)-cyclodecene-1,2-diamine.
What is the SMILES notation for (1Z)-cyclodecene-1,2-diamine?
The canonical SMILES for (1Z)-cyclodecene-1,2-diamine is N/C1=C(\N)CCCCCCCC1.
What is the InChIKey of (1Z)-cyclodecene-1,2-diamine?
The InChIKey is XNHCIMAISSXTLS-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H20N2/c11-9-7-5-3-1-2-4-6-8-10(9)12/h1-8,11-12H2/b10-9-.
What are the key properties of (1Z)-cyclodecene-1,2-diamine?
(1Z)-cyclodecene-1,2-diamine has a molecular weight of 168.28 g/mol, XLogP of 2.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-cyclodecene-1,2-diamine is sourced from PubChem (CID 89062858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).