C23H28FNO2 — CID 89062958
3-[4-[(1-butyl-3,4-dihydro-2H-quinolin-8-yl)oxymethyl]-2-fluorophenyl]propanal (PubChem CID 89062958) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is 3-[4-[(1-butyl-3,4-dihydro-2H-quinolin-8-yl)oxymethyl]-2-fluorophenyl]propanal.
| Compound Name | 3-[4-[(1-butyl-3,4-dihydro-2H-quinolin-8-yl)oxymethyl]-2-fluorophenyl]propanal |
|---|---|
| PubChem CID | 89062958 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-[4-[(1-butyl-3,4-dihydro-2H-quinolin-8-yl)oxymethyl]-2-fluorophenyl]propanal |
| SMILES | CCCCN1CCCc2cccc(OCc3ccc(CCC=O)c(F)c3)c21 |
| InChI | InChI=1S/C23H28FNO2/c1-2-3-13-25-14-5-8-20-7-4-10-22(23(20)25)27-17-18-11-12-19(9-6-15-26)21(24)16-18/h4,7,10-12,15-16H,2-3,5-6,8-9,13-14,17H2,1H3 |
| InChIKey | IRDBVHXFCMZCKG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|