About 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde
1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde (PubChem CID 89063587) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde.
Molecular Properties
| Compound Name | 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde |
| PubChem CID | 89063587 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde |
| SMILES | CCCCn1c(C=O)cc(=O)n(CCCC)c1=O |
| InChI | InChI=1S/C13H20N2O3/c1-3-5-7-14-11(10-16)9-12(17)15(13(14)18)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | VYKNZHKFLYYCSK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde?
The IUPAC name of 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde (CID 89063587) is 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde.
What is the SMILES notation for 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde?
The canonical SMILES for 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde is CCCCn1c(C=O)cc(=O)n(CCCC)c1=O.
What is the InChIKey of 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde?
The InChIKey is VYKNZHKFLYYCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-3-5-7-14-11(10-16)9-12(17)15(13(14)18)8-6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde?
1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde has a molecular weight of 252.31 g/mol, XLogP of 1.42, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutyl-2,6-dioxopyrimidine-4-carbaldehyde is sourced from PubChem (CID 89063587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).