C21H30S2 — CID 89063840
(1Z,5E,7Z)-3,4,9-trimethyl-1-(4-methylphenyl)undeca-1,5,7-triene-1,7-dithiol (PubChem CID 89063840) has the molecular formula C21H30S2 and a molecular weight of 346.61 g/mol. Its IUPAC name is (1Z,5E,7Z)-3,4,9-trimethyl-1-(4-methylphenyl)undeca-1,5,7-triene-1,7-dithiol.
| Compound Name | (1Z,5E,7Z)-3,4,9-trimethyl-1-(4-methylphenyl)undeca-1,5,7-triene-1,7-dithiol |
|---|---|
| PubChem CID | 89063840 |
| Molecular Formula | C21H30S2 |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1Z,5E,7Z)-3,4,9-trimethyl-1-(4-methylphenyl)undeca-1,5,7-triene-1,7-dithiol |
| SMILES | CCC(C)/C=C(S)/C=C/C(C)C(C)/C=C(\S)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H30S2/c1-6-15(2)13-20(22)12-9-17(4)18(5)14-21(23)19-10-7-16(3)8-11-19/h7-15,17-18,22-23H,6H2,1-5H3/b12-9+,20-13-,21-14- |
| InChIKey | ZJXRSBCPXFOLDT-PFBFIBNFSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|