About (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one
(5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one (PubChem CID 89063961) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one.
Molecular Properties
| Compound Name | (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one |
| PubChem CID | 89063961 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one |
| SMILES | CCC(C)/C=C1\C=CC(C)N(C)C1=O |
| InChI | InChI=1S/C12H19NO/c1-5-9(2)8-11-7-6-10(3)13(4)12(11)14/h6-10H,5H2,1-4H3/b11-8+ |
| InChIKey | RPNWYFBPOUSWKQ-DHZHZOJOSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one?
The IUPAC name of (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one (CID 89063961) is (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one.
What is the SMILES notation for (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one?
The canonical SMILES for (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one is CCC(C)/C=C1\C=CC(C)N(C)C1=O.
What is the InChIKey of (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one?
The InChIKey is RPNWYFBPOUSWKQ-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H19NO/c1-5-9(2)8-11-7-6-10(3)13(4)12(11)14/h6-10H,5H2,1-4H3/b11-8+.
What are the key properties of (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one?
(5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one has a molecular weight of 193.29 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-1,2-dimethyl-5-(2-methylbutylidene)-2H-pyridin-6-one is sourced from PubChem (CID 89063961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).