C14H24N2O3 — CID 89064246
(2S,4E,8E)-2-[(2-hydroxyacetyl)amino]-N-methylundeca-4,8-dienamide (PubChem CID 89064246) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2S,4E,8E)-2-[(2-hydroxyacetyl)amino]-N-methylundeca-4,8-dienamide.
| Compound Name | (2S,4E,8E)-2-[(2-hydroxyacetyl)amino]-N-methylundeca-4,8-dienamide |
|---|---|
| PubChem CID | 89064246 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2S,4E,8E)-2-[(2-hydroxyacetyl)amino]-N-methylundeca-4,8-dienamide |
| SMILES | CC/C=C/CC/C=C/C[C@H](NC(=O)CO)C(=O)NC |
| InChI | InChI=1S/C14H24N2O3/c1-3-4-5-6-7-8-9-10-12(14(19)15-2)16-13(18)11-17/h4-5,8-9,12,17H,3,6-7,10-11H2,1-2H3,(H,15,19)(H,16,18)/b5-4+,9-8+/t12-/m0/s1 |
| InChIKey | LJLXOOHERXTSIE-LGQFRCGNSA-N |
| XLogP | 0.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|