About N-[(E,2S)-1-oxohept-4-en-2-yl]formamide
N-[(E,2S)-1-oxohept-4-en-2-yl]formamide (PubChem CID 89064260) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[(E,2S)-1-oxohept-4-en-2-yl]formamide.
Molecular Properties
| Compound Name | N-[(E,2S)-1-oxohept-4-en-2-yl]formamide |
| PubChem CID | 89064260 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | N-[(E,2S)-1-oxohept-4-en-2-yl]formamide |
| SMILES | CC/C=C/C[C@@H](C=O)NC=O |
| InChI | InChI=1S/C8H13NO2/c1-2-3-4-5-8(6-10)9-7-11/h3-4,6-8H,2,5H2,1H3,(H,9,11)/b4-3+/t8-/m0/s1 |
| InChIKey | LKGPPKUWHIAOLZ-RTMURIBGSA-N |
| XLogP | 0.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E,2S)-1-oxohept-4-en-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,2S)-1-oxohept-4-en-2-yl]formamide?
The IUPAC name of N-[(E,2S)-1-oxohept-4-en-2-yl]formamide (CID 89064260) is N-[(E,2S)-1-oxohept-4-en-2-yl]formamide.
What is the SMILES notation for N-[(E,2S)-1-oxohept-4-en-2-yl]formamide?
The canonical SMILES for N-[(E,2S)-1-oxohept-4-en-2-yl]formamide is CC/C=C/C[C@@H](C=O)NC=O.
What is the InChIKey of N-[(E,2S)-1-oxohept-4-en-2-yl]formamide?
The InChIKey is LKGPPKUWHIAOLZ-RTMURIBGSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-3-4-5-8(6-10)9-7-11/h3-4,6-8H,2,5H2,1H3,(H,9,11)/b4-3+/t8-/m0/s1.
What are the key properties of N-[(E,2S)-1-oxohept-4-en-2-yl]formamide?
N-[(E,2S)-1-oxohept-4-en-2-yl]formamide has a molecular weight of 155.20 g/mol, XLogP of 0.66, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,2S)-1-oxohept-4-en-2-yl]formamide is sourced from PubChem (CID 89064260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).