C9H17NO2 — CID 89064352
(2S,4E,6E)-2-aminonona-4,6-diene-1,7-diol (PubChem CID 89064352) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (2S,4E,6E)-2-aminonona-4,6-diene-1,7-diol.
| Compound Name | (2S,4E,6E)-2-aminonona-4,6-diene-1,7-diol |
|---|---|
| PubChem CID | 89064352 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (2S,4E,6E)-2-aminonona-4,6-diene-1,7-diol |
| SMILES | CC/C(O)=C\C=C\C[C@H](N)CO |
| InChI | InChI=1S/C9H17NO2/c1-2-9(12)6-4-3-5-8(10)7-11/h3-4,6,8,11-12H,2,5,7,10H2,1H3/b4-3+,9-6+/t8-/m0/s1 |
| InChIKey | DOHPZWMVTRNMJY-WWRSIQAKSA-N |
| XLogP | 1.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|