About 2-N,6-dimethylpyridine-2,4-diamine
2-N,6-dimethylpyridine-2,4-diamine (PubChem CID 89064382) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-N,6-dimethylpyridine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,6-dimethylpyridine-2,4-diamine |
| PubChem CID | 89064382 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-N,6-dimethylpyridine-2,4-diamine |
| SMILES | CNc1cc(N)cc(C)n1 |
| InChI | InChI=1S/C7H11N3/c1-5-3-6(8)4-7(9-2)10-5/h3-4H,1-2H3,(H3,8,9,10) |
| InChIKey | TXMJFFQNMZIFRA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,6-dimethylpyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-dimethylpyridine-2,4-diamine?
The IUPAC name of 2-N,6-dimethylpyridine-2,4-diamine (CID 89064382) is 2-N,6-dimethylpyridine-2,4-diamine.
What is the SMILES notation for 2-N,6-dimethylpyridine-2,4-diamine?
The canonical SMILES for 2-N,6-dimethylpyridine-2,4-diamine is CNc1cc(N)cc(C)n1.
What is the InChIKey of 2-N,6-dimethylpyridine-2,4-diamine?
The InChIKey is TXMJFFQNMZIFRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5-3-6(8)4-7(9-2)10-5/h3-4H,1-2H3,(H3,8,9,10).
What are the key properties of 2-N,6-dimethylpyridine-2,4-diamine?
2-N,6-dimethylpyridine-2,4-diamine has a molecular weight of 137.19 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-dimethylpyridine-2,4-diamine is sourced from PubChem (CID 89064382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).