About (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine
(E)-N-ethoxypyrrolo[1,2-a]indol-4-imine (PubChem CID 89064506) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine.
Molecular Properties
| Compound Name | (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine |
| PubChem CID | 89064506 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine |
| SMILES | CCO/N=C1\c2ccccc2-n2cccc21 |
| InChI | InChI=1S/C13H12N2O/c1-2-16-14-13-10-6-3-4-7-11(10)15-9-5-8-12(13)15/h3-9H,2H2,1H3/b14-13+ |
| InChIKey | DNLVAWRVKZCIQW-BUHFOSPRSA-N |
| XLogP | 2.58 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine?
The IUPAC name of (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine (CID 89064506) is (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine.
What is the SMILES notation for (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine?
The canonical SMILES for (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine is CCO/N=C1\c2ccccc2-n2cccc21.
What is the InChIKey of (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine?
The InChIKey is DNLVAWRVKZCIQW-BUHFOSPRSA-N. The full InChI is InChI=1S/C13H12N2O/c1-2-16-14-13-10-6-3-4-7-11(10)15-9-5-8-12(13)15/h3-9H,2H2,1H3/b14-13+.
What are the key properties of (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine?
(E)-N-ethoxypyrrolo[1,2-a]indol-4-imine has a molecular weight of 212.25 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethoxypyrrolo[1,2-a]indol-4-imine is sourced from PubChem (CID 89064506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).