C13H20N2 — CID 89064931
(Z)-N'-methyl-N'-[(4Z,6Z)-3-methylidenenona-1,4,6-trien-2-yl]ethene-1,2-diamine (PubChem CID 89064931) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (Z)-N'-methyl-N'-[(4Z,6Z)-3-methylidenenona-1,4,6-trien-2-yl]ethene-1,2-diamine.
| Compound Name | (Z)-N'-methyl-N'-[(4Z,6Z)-3-methylidenenona-1,4,6-trien-2-yl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 89064931 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (Z)-N'-methyl-N'-[(4Z,6Z)-3-methylidenenona-1,4,6-trien-2-yl]ethene-1,2-diamine |
| SMILES | C=C(/C=C\C=C/CC)C(=C)N(C)/C=C\N |
| InChI | InChI=1S/C13H20N2/c1-5-6-7-8-9-12(2)13(3)15(4)11-10-14/h6-11H,2-3,5,14H2,1,4H3/b7-6-,9-8-,11-10- |
| InChIKey | PWOKQCDSLXGXTN-HAQUHOBPSA-N |
| XLogP | 2.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|