About methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate
methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate (PubChem CID 89065579) has the molecular formula C23H21FO4S
and a molecular weight of 412.48 g/mol. Its IUPAC name is methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate |
| PubChem CID | 89065579 |
| Molecular Formula | C23H21FO4S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate |
| SMILES | C=S(C)(=O)c1ccc(C(=O)c2cc(C(C)C(=O)OC)cc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C23H21FO4S/c1-14(23(26)28-2)17-11-16-5-8-18(24)13-20(16)21(12-17)22(25)15-6-9-19(10-7-15)29(3,4)27/h5-14H,3H2,1-2,4H3 |
| InChIKey | YQKMTPJCMYHOBW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate?
The IUPAC name of methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate (CID 89065579) is methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate.
What is the SMILES notation for methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate?
The canonical SMILES for methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate is C=S(C)(=O)c1ccc(C(=O)c2cc(C(C)C(=O)OC)cc3ccc(F)cc23)cc1.
What is the InChIKey of methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate?
The InChIKey is YQKMTPJCMYHOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21FO4S/c1-14(23(26)28-2)17-11-16-5-8-18(24)13-20(16)21(12-17)22(25)15-6-9-19(10-7-15)29(3,4)27/h5-14H,3H2,1-2,4H3.
What are the key properties of methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate?
methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate has a molecular weight of 412.48 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6-fluoro-4-[4-(methyl-methylidene-oxo-λ6-sulfanyl)benzoyl]naphthalen-2-yl]propanoate is sourced from PubChem (CID 89065579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).