C9H21NO3 — CID 89065686
(2S)-2-(1-hydroxybutylamino)-3-methylbutane-1,1-diol (PubChem CID 89065686) has the molecular formula C9H21NO3 and a molecular weight of 191.27 g/mol. Its IUPAC name is (2S)-2-(1-hydroxybutylamino)-3-methylbutane-1,1-diol.
| Compound Name | (2S)-2-(1-hydroxybutylamino)-3-methylbutane-1,1-diol |
|---|---|
| PubChem CID | 89065686 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | (2S)-2-(1-hydroxybutylamino)-3-methylbutane-1,1-diol |
| SMILES | CCCC(O)N[C@@H](C(C)C)C(O)O |
| InChI | InChI=1S/C9H21NO3/c1-4-5-7(11)10-8(6(2)3)9(12)13/h6-13H,4-5H2,1-3H3/t7?,8-/m0/s1 |
| InChIKey | QLHDZZMCCWMWAF-MQWKRIRWSA-N |
| XLogP | 0.03 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|