C32H33N5O3 — CID 89065812
(2S)-2-[[5-[3-[[(E)-4-(dimethylamino)but-2-enoxy]amino]phenyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]-2-phenylethanol (PubChem CID 89065812) has the molecular formula C32H33N5O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is (2S)-2-[[5-[3-[[(E)-4-(dimethylamino)but-2-enoxy]amino]phenyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]-2-phenylethanol.
| Compound Name | (2S)-2-[[5-[3-[[(E)-4-(dimethylamino)but-2-enoxy]amino]phenyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 89065812 |
| Molecular Formula | C32H33N5O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (2S)-2-[[5-[3-[[(E)-4-(dimethylamino)but-2-enoxy]amino]phenyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]-2-phenylethanol |
| SMILES | CN(C)C/C=C/CONc1cccc(-c2c(-c3ccccc3)oc3ncnc(N[C@H](CO)c4ccccc4)c23)c1 |
| InChI | InChI=1S/C32H33N5O3/c1-37(2)18-9-10-19-39-36-26-17-11-16-25(20-26)28-29-31(35-27(21-38)23-12-5-3-6-13-23)33-22-34-32(29)40-30(28)24-14-7-4-8-15-24/h3-17,20,22,27,36,38H,18-19,21H2,1-2H3,(H,33,34,35)/b10-9+/t27-/m1/s1 |
| InChIKey | PBDSLMHKFJDBOR-PCUWGRHASA-N |
| XLogP | 6.16 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|