About 4-(1,4-diazepan-1-yl)pyridin-3-amine
4-(1,4-diazepan-1-yl)pyridin-3-amine (PubChem CID 89066011) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 4-(1,4-diazepan-1-yl)pyridin-3-amine |
| PubChem CID | 89066011 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)pyridin-3-amine |
| SMILES | Nc1cnccc1N1CCCNCC1 |
| InChI | InChI=1S/C10H16N4/c11-9-8-13-4-2-10(9)14-6-1-3-12-5-7-14/h2,4,8,12H,1,3,5-7,11H2 |
| InChIKey | PBUGFKCSDRSNSC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,4-diazepan-1-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-diazepan-1-yl)pyridin-3-amine?
The IUPAC name of 4-(1,4-diazepan-1-yl)pyridin-3-amine (CID 89066011) is 4-(1,4-diazepan-1-yl)pyridin-3-amine.
What is the SMILES notation for 4-(1,4-diazepan-1-yl)pyridin-3-amine?
The canonical SMILES for 4-(1,4-diazepan-1-yl)pyridin-3-amine is Nc1cnccc1N1CCCNCC1.
What is the InChIKey of 4-(1,4-diazepan-1-yl)pyridin-3-amine?
The InChIKey is PBUGFKCSDRSNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c11-9-8-13-4-2-10(9)14-6-1-3-12-5-7-14/h2,4,8,12H,1,3,5-7,11H2.
What are the key properties of 4-(1,4-diazepan-1-yl)pyridin-3-amine?
4-(1,4-diazepan-1-yl)pyridin-3-amine has a molecular weight of 192.27 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-diazepan-1-yl)pyridin-3-amine is sourced from PubChem (CID 89066011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).