C18H17N3O3S — CID 89066019
methyl 2-[[2-(4-aminophenyl)-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-yl]oxy]acetate (PubChem CID 89066019) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 2-[[2-(4-aminophenyl)-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[2-(4-aminophenyl)-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 89066019 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | methyl 2-[[2-(4-aminophenyl)-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-yl]oxy]acetate |
| SMILES | COC(=O)COc1ccc2c(c1)SC1=NC(c3ccc(N)cc3)CN12 |
| InChI | InChI=1S/C18H17N3O3S/c1-23-17(22)10-24-13-6-7-15-16(8-13)25-18-20-14(9-21(15)18)11-2-4-12(19)5-3-11/h2-8,14H,9-10,19H2,1H3 |
| InChIKey | VPGRMKLOIDMDAS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|