C12H24O — CID 89066195
(2R)-2-(2,2,5,5-tetramethylhexan-3-yl)oxirane (PubChem CID 89066195) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (2R)-2-(2,2,5,5-tetramethylhexan-3-yl)oxirane.
| Compound Name | (2R)-2-(2,2,5,5-tetramethylhexan-3-yl)oxirane |
|---|---|
| PubChem CID | 89066195 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (2R)-2-(2,2,5,5-tetramethylhexan-3-yl)oxirane |
| SMILES | CC(C)(C)CC([C@@H]1CO1)C(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-11(2,3)7-9(10-8-13-10)12(4,5)6/h9-10H,7-8H2,1-6H3/t9?,10-/m0/s1 |
| InChIKey | FIOQLPOAYMVVIL-AXDSSHIGSA-N |
| XLogP | 3.48 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|