About (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile
(2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile (PubChem CID 89066197) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile |
| PubChem CID | 89066197 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C(N)=C\C(C#N)=C/C |
| InChI | InChI=1S/C8H10N2/c1-3-7(6-9)5-8(10)4-2/h3-5H,2,10H2,1H3/b7-3+,8-5+ |
| InChIKey | DBMZELMQDSRJAQ-IUMFQGNOSA-N |
| XLogP | 1.48 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile?
The IUPAC name of (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile (CID 89066197) is (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile.
What is the SMILES notation for (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile?
The canonical SMILES for (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile is C=C/C(N)=C\C(C#N)=C/C.
What is the InChIKey of (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile?
The InChIKey is DBMZELMQDSRJAQ-IUMFQGNOSA-N. The full InChI is InChI=1S/C8H10N2/c1-3-7(6-9)5-8(10)4-2/h3-5H,2,10H2,1H3/b7-3+,8-5+.
What are the key properties of (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile?
(2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile has a molecular weight of 134.18 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-4-amino-2-ethylidenehexa-3,5-dienenitrile is sourced from PubChem (CID 89066197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).