C12H22O4S — CID 89066271
(2S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioic S-acid (PubChem CID 89066271) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is (2S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioic S-acid.
| Compound Name | (2S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioic S-acid |
|---|---|
| PubChem CID | 89066271 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioic S-acid |
| SMILES | CC[C@@H](O)[C@H](C)C(O)C(C)C(=O)[C@H](C)C(=O)S |
| InChI | InChI=1S/C12H22O4S/c1-5-9(13)6(2)10(14)7(3)11(15)8(4)12(16)17/h6-10,13-14H,5H2,1-4H3,(H,16,17)/t6-,7?,8-,9+,10?/m0/s1 |
| InChIKey | KRKAZHNDKPTONY-FSGJKNLGSA-N |
| XLogP | 1.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|