C15H28O4S — CID 89066272
(2S,4R,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioic S-acid (PubChem CID 89066272) has the molecular formula C15H28O4S and a molecular weight of 304.45 g/mol. Its IUPAC name is (2S,4R,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioic S-acid.
| Compound Name | (2S,4R,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioic S-acid |
|---|---|
| PubChem CID | 89066272 |
| Molecular Formula | C15H28O4S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (2S,4R,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioic S-acid |
| SMILES | CC[C@@H](O)[C@H](C)C(O)C(C)C(=O)[C@H](C)C[C@H](C)C(=O)S |
| InChI | InChI=1S/C15H28O4S/c1-6-12(16)10(4)14(18)11(5)13(17)8(2)7-9(3)15(19)20/h8-12,14,16,18H,6-7H2,1-5H3,(H,19,20)/t8-,9+,10+,11?,12-,14?/m1/s1 |
| InChIKey | HHZCXVJPBZRACS-AOTQHRPGSA-N |
| XLogP | 2.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|