C6H8I2O3 — CID 89066299
(4R,5R,6R)-4-hydroxy-5,6-diiodo-3-methyloxan-2-one (PubChem CID 89066299) has the molecular formula C6H8I2O3 and a molecular weight of 381.94 g/mol. Its IUPAC name is (4R,5R,6R)-4-hydroxy-5,6-diiodo-3-methyloxan-2-one.
| Compound Name | (4R,5R,6R)-4-hydroxy-5,6-diiodo-3-methyloxan-2-one |
|---|---|
| PubChem CID | 89066299 |
| Molecular Formula | C6H8I2O3 |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.86 |
| IUPAC Name | (4R,5R,6R)-4-hydroxy-5,6-diiodo-3-methyloxan-2-one |
| SMILES | CC1C(=O)O[C@H](I)[C@H](I)[C@@H]1O |
| InChI | InChI=1S/C6H8I2O3/c1-2-4(9)3(7)5(8)11-6(2)10/h2-5,9H,1H3/t2?,3-,4-,5+/m1/s1 |
| InChIKey | MHPDAQYQNQNAEL-TYNDYHEPSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|