C75H70N2 — CID 89066331
CID 89066331 (PubChem CID 89066331) has the molecular formula C75H70N2 and a molecular weight of 999.40 g/mol.
| Compound Name | CID 89066331 |
|---|---|
| PubChem CID | 89066331 |
| Molecular Formula | C75H70N2 |
| Molecular Weight | 999.40 g/mol |
| Exact Mass | 998.55 |
| IUPAC Name | — |
| SMILES | C=CCC1C2=C(CCC=C2)C2(C(/C=C\C(=C)C3=C4C=CC=CC4C(C4C=CC5=C(C4)N=C(/C(C=C)=C/CCC)C(c4ccccc4)N5)c4ccccc43)=C(C)C3(C4=C(C=CCC4)c4ccccc43)c3ccccc32)/C1=C/C |
| InChI | InChI=1S/C75H70N2/c1-7-11-28-50(9-3)72-73(51-29-13-12-14-30-51)76-68-46-44-52(47-69(68)77-72)71-59-36-17-15-34-57(59)70(58-35-16-18-37-60(58)71)48(5)43-45-62-49(6)74(63-38-22-19-32-55(63)56-33-20-23-39-64(56)74)66-41-25-26-42-67(66)75(62)61(10-4)53(27-8-2)54-31-21-24-40-65(54)75/h8-10,12-22,25-26,28-38,41-46,52-53,59,71,73,76H,2-3,5,7,11,23-24,27,39-40,47H2,1,4,6H3/b45-43-,50-28+,61-10+ |
| InChIKey | XLWVQOICVTXXOE-ZHNNLYAASA-N |
| XLogP | 18.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.40 |
| LogP ≤ 5 | 18.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|