C8H9F2I — CID 89066393
(3Z,5Z)-2,6-difluoro-5-iodo-3-methylhepta-1,3,5-triene (PubChem CID 89066393) has the molecular formula C8H9F2I and a molecular weight of 270.06 g/mol. Its IUPAC name is (3Z,5Z)-2,6-difluoro-5-iodo-3-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-2,6-difluoro-5-iodo-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89066393 |
| Molecular Formula | C8H9F2I |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | (3Z,5Z)-2,6-difluoro-5-iodo-3-methylhepta-1,3,5-triene |
| SMILES | C=C(F)/C(C)=C\C(I)=C(/C)F |
| InChI | InChI=1S/C8H9F2I/c1-5(6(2)9)4-8(11)7(3)10/h4H,2H2,1,3H3/b5-4-,8-7- |
| InChIKey | ONPDQBHLZYNDAG-UTOQUPLUSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|