C15H15IN2 — CID 89066415
1-ethyl-2-(5-iodocyclohexa-1,3-dien-1-yl)benzimidazole (PubChem CID 89066415) has the molecular formula C15H15IN2 and a molecular weight of 350.20 g/mol. Its IUPAC name is 1-ethyl-2-(5-iodocyclohexa-1,3-dien-1-yl)benzimidazole.
| Compound Name | 1-ethyl-2-(5-iodocyclohexa-1,3-dien-1-yl)benzimidazole |
|---|---|
| PubChem CID | 89066415 |
| Molecular Formula | C15H15IN2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-ethyl-2-(5-iodocyclohexa-1,3-dien-1-yl)benzimidazole |
| SMILES | CCn1c(C2=CC=CC(I)C2)nc2ccccc21 |
| InChI | InChI=1S/C15H15IN2/c1-2-18-14-9-4-3-8-13(14)17-15(18)11-6-5-7-12(16)10-11/h3-9,12H,2,10H2,1H3 |
| InChIKey | LXBDTHXSTQXTSP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|