About N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine
N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 89066515) has the molecular formula C7H17ClN2
and a molecular weight of 164.68 g/mol. Its IUPAC name is N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| PubChem CID | 89066515 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)Cl |
| InChI | InChI=1S/C7H17ClN2/c1-7(2)6-9-4-5-10(3)8/h7,9H,4-6H2,1-3H3 |
| InChIKey | UNRZFYLIDZWRTI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine?
The IUPAC name of N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (CID 89066515) is N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
What is the SMILES notation for N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine?
The canonical SMILES for N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine is CC(C)CNCCN(C)Cl.
What is the InChIKey of N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine?
The InChIKey is UNRZFYLIDZWRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17ClN2/c1-7(2)6-9-4-5-10(3)8/h7,9H,4-6H2,1-3H3.
What are the key properties of N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine?
N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine has a molecular weight of 164.68 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-chloro-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine is sourced from PubChem (CID 89066515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).