About 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid
2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid (PubChem CID 89066646) has the molecular formula C12H22O7
and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid |
| PubChem CID | 89066646 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid |
| SMILES | CC/C=C(\C)COC(OC(CO)C(=O)O)C(O)CO |
| InChI | InChI=1S/C12H22O7/c1-3-4-8(2)7-18-12(9(15)5-13)19-10(6-14)11(16)17/h4,9-10,12-15H,3,5-7H2,1-2H3,(H,16,17)/b8-4+ |
| InChIKey | QRNJQVNWGFAZSX-XBXARRHUSA-N |
| XLogP | -0.50 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid?
The IUPAC name of 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid (CID 89066646) is 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid.
What is the SMILES notation for 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid?
The canonical SMILES for 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid is CC/C=C(\C)COC(OC(CO)C(=O)O)C(O)CO.
What is the InChIKey of 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid?
The InChIKey is QRNJQVNWGFAZSX-XBXARRHUSA-N. The full InChI is InChI=1S/C12H22O7/c1-3-4-8(2)7-18-12(9(15)5-13)19-10(6-14)11(16)17/h4,9-10,12-15H,3,5-7H2,1-2H3,(H,16,17)/b8-4+.
What are the key properties of 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid?
2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid has a molecular weight of 278.30 g/mol, XLogP of -0.50, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dihydroxy-1-[(E)-2-methylpent-2-enoxy]propoxy]-3-hydroxypropanoic acid is sourced from PubChem (CID 89066646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).