About 2-amino-3,4-dihydropyridine-5-carbonitrile
2-amino-3,4-dihydropyridine-5-carbonitrile (PubChem CID 89067159) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 2-amino-3,4-dihydropyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-3,4-dihydropyridine-5-carbonitrile |
| PubChem CID | 89067159 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 2-amino-3,4-dihydropyridine-5-carbonitrile |
| SMILES | N#CC1=CN=C(N)CC1 |
| InChI | InChI=1S/C6H7N3/c7-3-5-1-2-6(8)9-4-5/h4H,1-2H2,(H2,8,9) |
| InChIKey | JJJXOMDLJBEHMT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3,4-dihydropyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,4-dihydropyridine-5-carbonitrile?
The IUPAC name of 2-amino-3,4-dihydropyridine-5-carbonitrile (CID 89067159) is 2-amino-3,4-dihydropyridine-5-carbonitrile.
What is the SMILES notation for 2-amino-3,4-dihydropyridine-5-carbonitrile?
The canonical SMILES for 2-amino-3,4-dihydropyridine-5-carbonitrile is N#CC1=CN=C(N)CC1.
What is the InChIKey of 2-amino-3,4-dihydropyridine-5-carbonitrile?
The InChIKey is JJJXOMDLJBEHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c7-3-5-1-2-6(8)9-4-5/h4H,1-2H2,(H2,8,9).
What are the key properties of 2-amino-3,4-dihydropyridine-5-carbonitrile?
2-amino-3,4-dihydropyridine-5-carbonitrile has a molecular weight of 121.14 g/mol, XLogP of 0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,4-dihydropyridine-5-carbonitrile is sourced from PubChem (CID 89067159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).