About (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine
(3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine (PubChem CID 89067373) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine.
Molecular Properties
| Compound Name | (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine |
| PubChem CID | 89067373 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine |
| SMILES | C=CC[C@@H](CCN)[C@H](CC)NCCC |
| InChI | InChI=1S/C12H26N2/c1-4-7-11(8-9-13)12(6-3)14-10-5-2/h4,11-12,14H,1,5-10,13H2,2-3H3/t11-,12-/m0/s1 |
| InChIKey | YNAZLWIGBBAYON-RYUDHWBXSA-N |
| XLogP | 2.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine?
The IUPAC name of (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine (CID 89067373) is (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine.
What is the SMILES notation for (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine?
The canonical SMILES for (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine is C=CC[C@@H](CCN)[C@H](CC)NCCC.
What is the InChIKey of (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine?
The InChIKey is YNAZLWIGBBAYON-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H26N2/c1-4-7-11(8-9-13)12(6-3)14-10-5-2/h4,11-12,14H,1,5-10,13H2,2-3H3/t11-,12-/m0/s1.
What are the key properties of (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine?
(3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.31, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-prop-2-enyl-4-N-propylhexane-1,4-diamine is sourced from PubChem (CID 89067373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).