C16H25NO — CID 89067384
(2S,4S)-4-[(2Z,4Z)-2-(2-methylcyclobutyl)hexa-2,4-dienyl]pyrrolidine-2-carbaldehyde (PubChem CID 89067384) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (2S,4S)-4-[(2Z,4Z)-2-(2-methylcyclobutyl)hexa-2,4-dienyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S,4S)-4-[(2Z,4Z)-2-(2-methylcyclobutyl)hexa-2,4-dienyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 89067384 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (2S,4S)-4-[(2Z,4Z)-2-(2-methylcyclobutyl)hexa-2,4-dienyl]pyrrolidine-2-carbaldehyde |
| SMILES | C/C=C\C=C(\C[C@@H]1CN[C@H](C=O)C1)C1CCC1C |
| InChI | InChI=1S/C16H25NO/c1-3-4-5-14(16-7-6-12(16)2)8-13-9-15(11-18)17-10-13/h3-5,11-13,15-17H,6-10H2,1-2H3/b4-3-,14-5-/t12?,13-,15-,16?/m0/s1 |
| InChIKey | BFXIFSMPTYSECR-VPHYIWGBSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|