About 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole
2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole (PubChem CID 89067390) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole.
Analyze 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole?
The IUPAC name of 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole (CID 89067390) is 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole.
What is the SMILES notation for 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole?
The canonical SMILES for 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole is c1[nH]cc2c1OCCCS2.
What is the InChIKey of 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole?
The InChIKey is STXOVDJCBAUAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS/c1-2-9-6-4-8-5-7(6)10-3-1/h4-5,8H,1-3H2.
What are the key properties of 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole?
2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole has a molecular weight of 155.22 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,7-tetrahydro-[1,4]oxathiepino[2,3-c]pyrrole is sourced from PubChem (CID 89067390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).