About 5-amino-2-hydroxycyclohepta-2,6-dien-1-one
5-amino-2-hydroxycyclohepta-2,6-dien-1-one (PubChem CID 89067441) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 5-amino-2-hydroxycyclohepta-2,6-dien-1-one.
Molecular Properties
| Compound Name | 5-amino-2-hydroxycyclohepta-2,6-dien-1-one |
| PubChem CID | 89067441 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 5-amino-2-hydroxycyclohepta-2,6-dien-1-one |
| SMILES | NC1C=CC(=O)C(O)=CC1 |
| InChI | InChI=1S/C7H9NO2/c8-5-1-3-6(9)7(10)4-2-5/h1,3-5,10H,2,8H2 |
| InChIKey | KEULWWYAFGKGQV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-2-hydroxycyclohepta-2,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-hydroxycyclohepta-2,6-dien-1-one?
The IUPAC name of 5-amino-2-hydroxycyclohepta-2,6-dien-1-one (CID 89067441) is 5-amino-2-hydroxycyclohepta-2,6-dien-1-one.
What is the SMILES notation for 5-amino-2-hydroxycyclohepta-2,6-dien-1-one?
The canonical SMILES for 5-amino-2-hydroxycyclohepta-2,6-dien-1-one is NC1C=CC(=O)C(O)=CC1.
What is the InChIKey of 5-amino-2-hydroxycyclohepta-2,6-dien-1-one?
The InChIKey is KEULWWYAFGKGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c8-5-1-3-6(9)7(10)4-2-5/h1,3-5,10H,2,8H2.
What are the key properties of 5-amino-2-hydroxycyclohepta-2,6-dien-1-one?
5-amino-2-hydroxycyclohepta-2,6-dien-1-one has a molecular weight of 139.15 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-hydroxycyclohepta-2,6-dien-1-one is sourced from PubChem (CID 89067441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).