C22H29FN6O3 — CID 89067481
[(2R)-1-acetamido-3-[3-fluoro-4-[1-(pyridin-2-ylmethyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate (PubChem CID 89067481) has the molecular formula C22H29FN6O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is [(2R)-1-acetamido-3-[3-fluoro-4-[1-(pyridin-2-ylmethyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate.
| Compound Name | [(2R)-1-acetamido-3-[3-fluoro-4-[1-(pyridin-2-ylmethyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate |
|---|---|
| PubChem CID | 89067481 |
| Molecular Formula | C22H29FN6O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(2R)-1-acetamido-3-[3-fluoro-4-[1-(pyridin-2-ylmethyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate |
| SMILES | CC(=O)NC[C@@H](CNc1ccc(N2CCNN(Cc3ccccn3)CC2)c(F)c1)OC=O |
| InChI | InChI=1S/C22H29FN6O3/c1-17(31)25-13-20(32-16-30)14-26-18-5-6-22(21(23)12-18)28-9-8-27-29(11-10-28)15-19-4-2-3-7-24-19/h2-7,12,16,20,26-27H,8-11,13-15H2,1H3,(H,25,31)/t20-/m0/s1 |
| InChIKey | XJHMJJWXQAJAEM-FQEVSTJZSA-N |
| XLogP | 1.14 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|