C50H48N2 — CID 89067517
N-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-N-phenylnaphthalen-1-amine (PubChem CID 89067517) has the molecular formula C50H48N2 and a molecular weight of 676.95 g/mol. Its IUPAC name is N-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-N-phenylnaphthalen-1-amine.
| Compound Name | N-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-N-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 89067517 |
| Molecular Formula | C50H48N2 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | N-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-N-phenylnaphthalen-1-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(/C=C/c3ccc(N(c4ccccc4)c4cccc5ccccc45)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C50H48N2/c1-49(2,3)40-25-33-44(34-26-40)51(45-35-27-41(28-36-45)50(4,5)6)43-29-21-37(22-30-43)19-20-38-23-31-46(32-24-38)52(42-15-8-7-9-16-42)48-18-12-14-39-13-10-11-17-47(39)48/h7-36H,1-6H3/b20-19+ |
| InChIKey | QWQPZBYDAHIMFT-FMQUCBEESA-N |
| XLogP | 14.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|