About (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide
(3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide (PubChem CID 89068370) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide |
| PubChem CID | 89068370 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C/N)CC(=O)NCC |
| InChI | InChI=1S/C10H16N2O/c1-3-5-9(6-7-11)8-10(13)12-4-2/h3,5-7H,1,4,8,11H2,2H3,(H,12,13)/b7-6-,9-5+ |
| InChIKey | IECDUTIGQOHSLD-QRLJIZSYSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide?
The IUPAC name of (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide (CID 89068370) is (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide.
What is the SMILES notation for (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide?
The canonical SMILES for (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide is C=C/C=C(\C=C/N)CC(=O)NCC.
What is the InChIKey of (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide?
The InChIKey is IECDUTIGQOHSLD-QRLJIZSYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-3-5-9(6-7-11)8-10(13)12-4-2/h3,5-7H,1,4,8,11H2,2H3,(H,12,13)/b7-6-,9-5+.
What are the key properties of (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide?
(3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide has a molecular weight of 180.25 g/mol, XLogP of 1.10, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(Z)-2-aminoethenyl]-N-ethylhexa-3,5-dienamide is sourced from PubChem (CID 89068370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).