About (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one
(3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one (PubChem CID 89068403) has the molecular formula C19H14BrNO
and a molecular weight of 352.23 g/mol. Its IUPAC name is (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one |
| PubChem CID | 89068403 |
| Molecular Formula | C19H14BrNO |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Br)ccc2/C1=C/C1=CC=C2C=CC=CCC21 |
| InChI | InChI=1S/C19H14BrNO/c20-14-8-9-16-17(19(22)21-18(16)11-14)10-13-7-6-12-4-2-1-3-5-15(12)13/h1-4,6-11,15H,5H2,(H,21,22)/b17-10- |
| InChIKey | ONXXNUQJHBWZMF-YVLHZVERSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one?
The IUPAC name of (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one (CID 89068403) is (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one.
What is the SMILES notation for (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one?
The canonical SMILES for (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one is O=C1Nc2cc(Br)ccc2/C1=C/C1=CC=C2C=CC=CCC21.
What is the InChIKey of (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one?
The InChIKey is ONXXNUQJHBWZMF-YVLHZVERSA-N. The full InChI is InChI=1S/C19H14BrNO/c20-14-8-9-16-17(19(22)21-18(16)11-14)10-13-7-6-12-4-2-1-3-5-15(12)13/h1-4,6-11,15H,5H2,(H,21,22)/b17-10-.
What are the key properties of (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one?
(3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one has a molecular weight of 352.23 g/mol, XLogP of 4.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(8,8a-dihydroazulen-1-ylmethylidene)-6-bromo-1H-indol-2-one is sourced from PubChem (CID 89068403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).