C34H29NO4 — CID 89068646
5-[(2E)-2-(1-benzyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-cyclopenta-1,3-dien-1-yl-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 89068646) has the molecular formula C34H29NO4 and a molecular weight of 515.61 g/mol. Its IUPAC name is 5-[(2E)-2-(1-benzyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-cyclopenta-1,3-dien-1-yl-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2E)-2-(1-benzyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-cyclopenta-1,3-dien-1-yl-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 89068646 |
| Molecular Formula | C34H29NO4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 5-[(2E)-2-(1-benzyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-cyclopenta-1,3-dien-1-yl-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)/C(=C\C=C2C(=O)OC(C3=CC=CC3)(c3ccccc3)OC2=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C34H29NO4/c1-33(2)28-19-11-12-20-29(28)35(23-24-13-5-3-6-14-24)30(33)22-21-27-31(36)38-34(39-32(27)37,26-17-9-10-18-26)25-15-7-4-8-16-25/h3-17,19-22H,18,23H2,1-2H3/b27-21-,30-22+ |
| InChIKey | NOELBTYTOHNMSU-FWGTZXQUSA-N |
| XLogP | 6.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|