About prop-1-en-2-yl 2-(4-methoxyphenyl)acetate
prop-1-en-2-yl 2-(4-methoxyphenyl)acetate (PubChem CID 89069215) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is prop-1-en-2-yl 2-(4-methoxyphenyl)acetate.
Molecular Properties
| Compound Name | prop-1-en-2-yl 2-(4-methoxyphenyl)acetate |
| PubChem CID | 89069215 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | prop-1-en-2-yl 2-(4-methoxyphenyl)acetate |
| SMILES | C=C(C)OC(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H14O3/c1-9(2)15-12(13)8-10-4-6-11(14-3)7-5-10/h4-7H,1,8H2,2-3H3 |
| InChIKey | VPRGTRMJOVHINU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl 2-(4-methoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl 2-(4-methoxyphenyl)acetate?
The IUPAC name of prop-1-en-2-yl 2-(4-methoxyphenyl)acetate (CID 89069215) is prop-1-en-2-yl 2-(4-methoxyphenyl)acetate.
What is the SMILES notation for prop-1-en-2-yl 2-(4-methoxyphenyl)acetate?
The canonical SMILES for prop-1-en-2-yl 2-(4-methoxyphenyl)acetate is C=C(C)OC(=O)Cc1ccc(OC)cc1.
What is the InChIKey of prop-1-en-2-yl 2-(4-methoxyphenyl)acetate?
The InChIKey is VPRGTRMJOVHINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-9(2)15-12(13)8-10-4-6-11(14-3)7-5-10/h4-7H,1,8H2,2-3H3.
What are the key properties of prop-1-en-2-yl 2-(4-methoxyphenyl)acetate?
prop-1-en-2-yl 2-(4-methoxyphenyl)acetate has a molecular weight of 206.24 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl 2-(4-methoxyphenyl)acetate is sourced from PubChem (CID 89069215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).